C16H16BrO3P — CID 11824723
(4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2-dioxaphosphepane (PubChem CID 11824723) has the molecular formula C16H16BrO3P and a molecular weight of 367.18 g/mol. Its IUPAC name is (4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2-dioxaphosphepane.
| Compound Name | (4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2-dioxaphosphepane |
|---|---|
| PubChem CID | 11824723 |
| Molecular Formula | C16H16BrO3P |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | (4S,5R)-5-bromo-2-phenoxy-4-phenyl-1,3,2-dioxaphosphepane |
| SMILES | Br[C@@H]1CCOP(Oc2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16BrO3P/c17-15-11-12-18-21(19-14-9-5-2-6-10-14)20-16(15)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16+,21?/m1/s1 |
| InChIKey | HINGWAQCLYLOHW-ZQIYAJFXSA-N |
| XLogP | 5.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|