C11H15O5P — CID 142743096
2-hydroxy-4-phenoxy-1,3,2λ5-dioxaphosphocane 2-oxide (PubChem CID 142743096) has the molecular formula C11H15O5P and a molecular weight of 258.21 g/mol. Its IUPAC name is 2-hydroxy-4-phenoxy-1,3,2λ5-dioxaphosphocane 2-oxide.
| Compound Name | 2-hydroxy-4-phenoxy-1,3,2λ5-dioxaphosphocane 2-oxide |
|---|---|
| PubChem CID | 142743096 |
| Molecular Formula | C11H15O5P |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-hydroxy-4-phenoxy-1,3,2λ5-dioxaphosphocane 2-oxide |
| SMILES | O=P1(O)OCCCCC(Oc2ccccc2)O1 |
| InChI | InChI=1S/C11H15O5P/c12-17(13)14-9-5-4-8-11(16-17)15-10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2,(H,12,13) |
| InChIKey | OXCXNPFKRAKYJS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|