C21H23O8P — CID 25188812
(1S,2R,6R,8R,9S,11R)-9-(4-methoxyphenyl)-4,4-dimethyl-11-phenoxy-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide (PubChem CID 25188812) has the molecular formula C21H23O8P and a molecular weight of 434.38 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S,11R)-9-(4-methoxyphenyl)-4,4-dimethyl-11-phenoxy-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide.
| Compound Name | (1S,2R,6R,8R,9S,11R)-9-(4-methoxyphenyl)-4,4-dimethyl-11-phenoxy-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
|---|---|
| PubChem CID | 25188812 |
| Molecular Formula | C21H23O8P |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (1S,2R,6R,8R,9S,11R)-9-(4-methoxyphenyl)-4,4-dimethyl-11-phenoxy-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
| SMILES | COc1ccc([C@@H]2O[P@@](=O)(Oc3ccccc3)O[C@@H]3[C@H]4OC(C)(C)O[C@H]4O[C@@H]32)cc1 |
| InChI | InChI=1S/C21H23O8P/c1-21(2)25-19-18-17(24-20(19)26-21)16(13-9-11-14(23-3)12-10-13)28-30(22,29-18)27-15-7-5-4-6-8-15/h4-12,16-20H,1-3H3/t16-,17+,18-,19+,20+,30+/m0/s1 |
| InChIKey | LMZGGJLRROBVBP-OYHWXLCSSA-N |
| XLogP | 4.22 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|