C20H20ClO6P — CID 102291283
(1S,2R,6R,8R,9R)-9-(4-chlorophenyl)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide (PubChem CID 102291283) has the molecular formula C20H20ClO6P and a molecular weight of 422.80 g/mol. Its IUPAC name is (1S,2R,6R,8R,9R)-9-(4-chlorophenyl)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide.
| Compound Name | (1S,2R,6R,8R,9R)-9-(4-chlorophenyl)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
|---|---|
| PubChem CID | 102291283 |
| Molecular Formula | C20H20ClO6P |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | (1S,2R,6R,8R,9R)-9-(4-chlorophenyl)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OP(=O)(c4ccccc4)O[C@@H]3c3ccc(Cl)cc3)[C@H]2O1 |
| InChI | InChI=1S/C20H20ClO6P/c1-20(2)24-18-17-16(23-19(18)25-20)15(12-8-10-13(21)11-9-12)26-28(22,27-17)14-6-4-3-5-7-14/h3-11,15-19H,1-2H3/t15-,16-,17+,18-,19-,28?/m1/s1 |
| InChIKey | LWBVQZUSDYHNIS-SHROLXDSSA-N |
| XLogP | 4.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|