C10H16IO6P — CID 102010840
(1S,2R,6R,8S,9S)-9-(iodomethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide (PubChem CID 102010840) has the molecular formula C10H16IO6P and a molecular weight of 390.11 g/mol. Its IUPAC name is (1S,2R,6R,8S,9S)-9-(iodomethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide.
| Compound Name | (1S,2R,6R,8S,9S)-9-(iodomethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
|---|---|
| PubChem CID | 102010840 |
| Molecular Formula | C10H16IO6P |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | (1S,2R,6R,8S,9S)-9-(iodomethyl)-4,4,11-trimethyl-3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OP(C)(=O)O[C@@H]3CI)[C@H]2O1 |
| InChI | InChI=1S/C10H16IO6P/c1-10(2)14-8-7-6(13-9(8)15-10)5(4-11)16-18(3,12)17-7/h5-9H,4H2,1-3H3/t5-,6-,7+,8-,9-,18?/m1/s1 |
| InChIKey | COJOCBCCQGELPU-KICZKRAESA-N |
| XLogP | 1.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|