C24H29NO6 — CID 131882990
2-[N-[[(1S,2R,6R,8R,9R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methyl]anilino]ethanol (PubChem CID 131882990) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[N-[[(1S,2R,6R,8R,9R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methyl]anilino]ethanol.
| Compound Name | 2-[N-[[(1S,2R,6R,8R,9R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methyl]anilino]ethanol |
|---|---|
| PubChem CID | 131882990 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[N-[[(1S,2R,6R,8R,9R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methyl]anilino]ethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC(c4ccccc4)O[C@@H]3CN(CCO)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C24H29NO6/c1-24(2)30-21-20-19(28-23(21)31-24)18(27-22(29-20)16-9-5-3-6-10-16)15-25(13-14-26)17-11-7-4-8-12-17/h3-12,18-23,26H,13-15H2,1-2H3/t18-,19-,20+,21-,22?,23-/m1/s1 |
| InChIKey | RLFNKZCKXDYWCT-YYKQMJRKSA-N |
| XLogP | 2.84 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |