C17H21IO5 — CID 102171507
(1R,2S,6S,8S,9R,11R)-9-iodo-11-(4-methoxyphenyl)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 102171507) has the molecular formula C17H21IO5 and a molecular weight of 432.25 g/mol. Its IUPAC name is (1R,2S,6S,8S,9R,11R)-9-iodo-11-(4-methoxyphenyl)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1R,2S,6S,8S,9R,11R)-9-iodo-11-(4-methoxyphenyl)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 102171507 |
| Molecular Formula | C17H21IO5 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | (1R,2S,6S,8S,9R,11R)-9-iodo-11-(4-methoxyphenyl)-4,4-dimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | COc1ccc([C@H]2C[C@@H](I)[C@H]3O[C@H]4OC(C)(C)O[C@H]4[C@H]3O2)cc1 |
| InChI | InChI=1S/C17H21IO5/c1-17(2)22-15-14-13(21-16(15)23-17)11(18)8-12(20-14)9-4-6-10(19-3)7-5-9/h4-7,11-16H,8H2,1-3H3/t11-,12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | DWJBGECJFMKWIC-ODICJLLRSA-N |
| XLogP | 3.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|