C14H21N2O2P — CID 11536456
(2S,4aR,8aR)-3-methyl-2-phenoxy-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]diazaphosphinine 2-oxide (PubChem CID 11536456) has the molecular formula C14H21N2O2P and a molecular weight of 280.31 g/mol. Its IUPAC name is (2S,4aR,8aR)-3-methyl-2-phenoxy-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]diazaphosphinine 2-oxide.
| Compound Name | (2S,4aR,8aR)-3-methyl-2-phenoxy-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]diazaphosphinine 2-oxide |
|---|---|
| PubChem CID | 11536456 |
| Molecular Formula | C14H21N2O2P |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2S,4aR,8aR)-3-methyl-2-phenoxy-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]diazaphosphinine 2-oxide |
| SMILES | CN1C[C@H]2CCCC[C@H]2N[P@]1(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H21N2O2P/c1-16-11-12-7-5-6-10-14(12)15-19(16,17)18-13-8-3-2-4-9-13/h2-4,8-9,12,14H,5-7,10-11H2,1H3,(H,15,17)/t12-,14-,19+/m1/s1 |
| InChIKey | XNXKOBKLVILKIK-TVZGQMOCSA-N |
| XLogP | 3.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|