C11H11O4P — CID 142711376
6-ethenyl-2-phenoxy-4H-1,3,2λ5-dioxaphosphinine 2-oxide (PubChem CID 142711376) has the molecular formula C11H11O4P and a molecular weight of 238.18 g/mol. Its IUPAC name is 6-ethenyl-2-phenoxy-4H-1,3,2λ5-dioxaphosphinine 2-oxide.
| Compound Name | 6-ethenyl-2-phenoxy-4H-1,3,2λ5-dioxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 142711376 |
| Molecular Formula | C11H11O4P |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-ethenyl-2-phenoxy-4H-1,3,2λ5-dioxaphosphinine 2-oxide |
| SMILES | C=CC1=CCOP(=O)(Oc2ccccc2)O1 |
| InChI | InChI=1S/C11H11O4P/c1-2-10-8-9-13-16(12,14-10)15-11-6-4-3-5-7-11/h2-8H,1,9H2 |
| InChIKey | GPKCOBNSTAITNW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|