C15H17Cl2N4OP3 — CID 102578774
4,4-dichloro-2,2-diphenyl-7-oxa-1,3,5,11-tetraza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1(6),2,4-triene (PubChem CID 102578774) has the molecular formula C15H17Cl2N4OP3 and a molecular weight of 433.16 g/mol. Its IUPAC name is 4,4-dichloro-2,2-diphenyl-7-oxa-1,3,5,11-tetraza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1(6),2,4-triene.
| Compound Name | 4,4-dichloro-2,2-diphenyl-7-oxa-1,3,5,11-tetraza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1(6),2,4-triene |
|---|---|
| PubChem CID | 102578774 |
| Molecular Formula | C15H17Cl2N4OP3 |
| Molecular Weight | 433.16 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 4,4-dichloro-2,2-diphenyl-7-oxa-1,3,5,11-tetraza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1(6),2,4-triene |
| SMILES | ClP1(Cl)=NP2(=NP(c3ccccc3)(c3ccccc3)=N1)NCCCO2 |
| InChI | InChI=1S/C15H17Cl2N4OP3/c16-24(17)19-23(14-8-3-1-4-9-14,15-10-5-2-6-11-15)20-25(21-24)18-12-7-13-22-25/h1-6,8-11,18H,7,12-13H2 |
| InChIKey | QIDFEJLRSAMTTC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.16 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|