C18H24N5O2P3S2 — CID 139045287
(6R,8S)-15,15-bis(phenylsulfanyl)-5,13-dioxa-1,7,9,14,16-pentaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene (PubChem CID 139045287) has the molecular formula C18H24N5O2P3S2 and a molecular weight of 499.48 g/mol. Its IUPAC name is (6R,8S)-15,15-bis(phenylsulfanyl)-5,13-dioxa-1,7,9,14,16-pentaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene.
| Compound Name | (6R,8S)-15,15-bis(phenylsulfanyl)-5,13-dioxa-1,7,9,14,16-pentaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
|---|---|
| PubChem CID | 139045287 |
| Molecular Formula | C18H24N5O2P3S2 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | (6R,8S)-15,15-bis(phenylsulfanyl)-5,13-dioxa-1,7,9,14,16-pentaza-6λ5,8λ5,15λ5-triphosphadispiro[5.1.58.36]hexadeca-6,8(14),15-triene |
| SMILES | c1ccc(SP2(Sc3ccccc3)=N[P@]3(=N[P@@]4(=N2)NCCCO4)NCCCO3)cc1 |
| InChI | InChI=1S/C18H24N5O2P3S2/c1-3-9-17(10-4-1)29-28(30-18-11-5-2-6-12-18)22-26(19-13-7-15-24-26)21-27(23-28)20-14-8-16-25-27/h1-6,9-12,19-20H,7-8,13-16H2/t26-,27-/m1/s1 |
| InChIKey | HTYQSBUXIWGHAP-KAYWLYCHSA-N |
| XLogP | 7.44 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|