C18H25N5O2P3S2+ — CID 139045278
(6S)-15,15-bis(phenylsulfanyl)-5,9-dioxa-1,7,13,14,16-pentaza-6λ5,15λ5-diphospha-8-phosphoniadispiro[5.1.58.36]hexadeca-6,14-diene (PubChem CID 139045278) has the molecular formula C18H25N5O2P3S2+ and a molecular weight of 500.49 g/mol. Its IUPAC name is (6S)-15,15-bis(phenylsulfanyl)-5,9-dioxa-1,7,13,14,16-pentaza-6λ5,15λ5-diphospha-8-phosphoniadispiro[5.1.58.36]hexadeca-6,14-diene.
| Compound Name | (6S)-15,15-bis(phenylsulfanyl)-5,9-dioxa-1,7,13,14,16-pentaza-6λ5,15λ5-diphospha-8-phosphoniadispiro[5.1.58.36]hexadeca-6,14-diene |
|---|---|
| PubChem CID | 139045278 |
| Molecular Formula | C18H25N5O2P3S2+ |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | (6S)-15,15-bis(phenylsulfanyl)-5,9-dioxa-1,7,13,14,16-pentaza-6λ5,15λ5-diphospha-8-phosphoniadispiro[5.1.58.36]hexadeca-6,14-diene |
| SMILES | c1ccc(SP2(Sc3ccccc3)=N[P+]3(N=[P@@]4(NCCCO4)N2)NCCCO3)cc1 |
| InChI | InChI=1S/C18H25N5O2P3S2/c1-3-9-17(10-4-1)29-28(30-18-11-5-2-6-12-18)22-26(19-13-7-15-24-26)21-27(23-28)20-14-8-16-25-27/h1-6,9-12,19-20,22H,7-8,13-16H2/q+1/t26-,27?/m0/s1 |
| InChIKey | NBYSAESRPABTKB-QBHOUYDASA-N |
| XLogP | 6.76 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|