C17H20NO3P — CID 141046852
2-(4-phenoxyphenyl)-1,3,2λ5-oxazaphosphocane 2-oxide (PubChem CID 141046852) has the molecular formula C17H20NO3P and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-(4-phenoxyphenyl)-1,3,2λ5-oxazaphosphocane 2-oxide.
| Compound Name | 2-(4-phenoxyphenyl)-1,3,2λ5-oxazaphosphocane 2-oxide |
|---|---|
| PubChem CID | 141046852 |
| Molecular Formula | C17H20NO3P |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(4-phenoxyphenyl)-1,3,2λ5-oxazaphosphocane 2-oxide |
| SMILES | O=P1(c2ccc(Oc3ccccc3)cc2)NCCCCCO1 |
| InChI | InChI=1S/C17H20NO3P/c19-22(18-13-5-2-6-14-20-22)17-11-9-16(10-12-17)21-15-7-3-1-4-8-15/h1,3-4,7-12H,2,5-6,13-14H2,(H,18,19) |
| InChIKey | PSAUSBYFPMDKNF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|