C17H20Cl3N4O2P3 — CID 101420044
N,N-dibenzyl-2,4,4-trichloro-7,11-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1,3,5-trien-2-amine (PubChem CID 101420044) has the molecular formula C17H20Cl3N4O2P3 and a molecular weight of 511.65 g/mol. Its IUPAC name is N,N-dibenzyl-2,4,4-trichloro-7,11-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1,3,5-trien-2-amine.
| Compound Name | N,N-dibenzyl-2,4,4-trichloro-7,11-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 101420044 |
| Molecular Formula | C17H20Cl3N4O2P3 |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | N,N-dibenzyl-2,4,4-trichloro-7,11-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.5]undeca-1,3,5-trien-2-amine |
| SMILES | ClP1(Cl)=NP(Cl)(N(Cc2ccccc2)Cc2ccccc2)=NP2(=N1)OCCCO2 |
| InChI | InChI=1S/C17H20Cl3N4O2P3/c18-27(19)21-28(20,23-29(22-27)25-12-7-13-26-29)24(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-6,8-11H,7,12-15H2 |
| InChIKey | WMZSLASYQDURHY-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 58.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|