C28H28Cl6N6P4 — CID 23417945
2-N,2-N,4-N,4-N-tetrabenzyl-2,4,6,6,8,8-hexachloro-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,4-diamine (PubChem CID 23417945) has the molecular formula C28H28Cl6N6P4 and a molecular weight of 785.19 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetrabenzyl-2,4,6,6,8,8-hexachloro-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetrabenzyl-2,4,6,6,8,8-hexachloro-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,4-diamine |
|---|---|
| PubChem CID | 23417945 |
| Molecular Formula | C28H28Cl6N6P4 |
| Molecular Weight | 785.19 g/mol |
| Exact Mass | 781.95 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetrabenzyl-2,4,6,6,8,8-hexachloro-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,4-diamine |
| SMILES | ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(N(Cc2ccccc2)Cc2ccccc2)=NP(Cl)(N(Cc2ccccc2)Cc2ccccc2)=N1 |
| InChI | InChI=1S/C28H28Cl6N6P4/c29-41(30)35-42(31,32)37-44(34,40(23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28)38-43(33,36-41)39(21-25-13-5-1-6-14-25)22-26-15-7-2-8-16-26/h1-20H,21-24H2 |
| InChIKey | HTAALZVUKCXGEQ-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.19 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|