C11H16Cl6N6P4 — CID 177454306
5-benzyl-8,8,10,10,12,12-hexachloro-1-methyl-1,5,7,9,11,13-hexaza-6λ5,8λ5,10λ5,12λ5-tetraphosphaspiro[5.7]trideca-6(13),7,9,11-tetraene (PubChem CID 177454306) has the molecular formula C11H16Cl6N6P4 and a molecular weight of 568.91 g/mol. Its IUPAC name is 5-benzyl-8,8,10,10,12,12-hexachloro-1-methyl-1,5,7,9,11,13-hexaza-6λ5,8λ5,10λ5,12λ5-tetraphosphaspiro[5.7]trideca-6(13),7,9,11-tetraene.
| Compound Name | 5-benzyl-8,8,10,10,12,12-hexachloro-1-methyl-1,5,7,9,11,13-hexaza-6λ5,8λ5,10λ5,12λ5-tetraphosphaspiro[5.7]trideca-6(13),7,9,11-tetraene |
|---|---|
| PubChem CID | 177454306 |
| Molecular Formula | C11H16Cl6N6P4 |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 565.85 |
| IUPAC Name | 5-benzyl-8,8,10,10,12,12-hexachloro-1-methyl-1,5,7,9,11,13-hexaza-6λ5,8λ5,10λ5,12λ5-tetraphosphaspiro[5.7]trideca-6(13),7,9,11-tetraene |
| SMILES | CN1CCCN(Cc2ccccc2)P12=NP(Cl)(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N2 |
| InChI | InChI=1S/C11H16Cl6N6P4/c1-22-8-5-9-23(10-11-6-3-2-4-7-11)27(22)20-25(14,15)18-24(12,13)19-26(16,17)21-27/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | JBQJBCMEGFOMHF-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|