C17H18O4P2 — CID 12518092
3,9-diphenyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 12518092) has the molecular formula C17H18O4P2 and a molecular weight of 348.27 g/mol. Its IUPAC name is 3,9-diphenyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-diphenyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 12518092 |
| Molecular Formula | C17H18O4P2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3,9-diphenyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | c1ccc(P2OCC3(CO2)COP(c2ccccc2)OC3)cc1 |
| InChI | InChI=1S/C17H18O4P2/c1-3-7-15(8-4-1)22-18-11-17(12-19-22)13-20-23(21-14-17)16-9-5-2-6-10-16/h1-10H,11-14H2 |
| InChIKey | APECIMRFBOIRSX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|