C12H15P — CID 12706078
2,5-dimethyl-1-phenyl-2,3-dihydrophosphole (PubChem CID 12706078) has the molecular formula C12H15P and a molecular weight of 190.23 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-2,3-dihydrophosphole.
| Compound Name | 2,5-dimethyl-1-phenyl-2,3-dihydrophosphole |
|---|---|
| PubChem CID | 12706078 |
| Molecular Formula | C12H15P |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-2,3-dihydrophosphole |
| SMILES | CC1=CCC(C)P1c1ccccc1 |
| InChI | InChI=1S/C12H15P/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3 |
| InChIKey | KDRSLADFMFVJES-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|