C12H17P — CID 11732644
3,4-dimethyl-1-phenylphospholane (PubChem CID 11732644) has the molecular formula C12H17P and a molecular weight of 192.24 g/mol. Its IUPAC name is 3,4-dimethyl-1-phenylphospholane.
| Compound Name | 3,4-dimethyl-1-phenylphospholane |
|---|---|
| PubChem CID | 11732644 |
| Molecular Formula | C12H17P |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3,4-dimethyl-1-phenylphospholane |
| SMILES | CC1CP(c2ccccc2)CC1C |
| InChI | InChI=1S/C12H17P/c1-10-8-13(9-11(10)2)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | XTJGFLMZBPVQEH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|