C14H23P3 — CID 16686339
3-methyl-1-phenyl-1,4,7-triphosphecane (PubChem CID 16686339) has the molecular formula C14H23P3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 3-methyl-1-phenyl-1,4,7-triphosphecane.
| Compound Name | 3-methyl-1-phenyl-1,4,7-triphosphecane |
|---|---|
| PubChem CID | 16686339 |
| Molecular Formula | C14H23P3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-methyl-1-phenyl-1,4,7-triphosphecane |
| SMILES | CC1CP(c2ccccc2)CCCPCCP1 |
| InChI | InChI=1S/C14H23P3/c1-13-12-17(14-6-3-2-4-7-14)11-5-8-15-9-10-16-13/h2-4,6-7,13,15-16H,5,8-12H2,1H3 |
| InChIKey | MGLWAGOBNJXUKO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|