C46H62ClF5P2Pt — CID 11320642
chloroplatinum(1+);(8E,23E)-1,16-diphenyl-1,16-diphosphacyclotriaconta-8,23-diene;1,2,3,4,5-pentafluorobenzene-6-ide (PubChem CID 11320642) has the molecular formula C46H62ClF5P2Pt and a molecular weight of 1002.47 g/mol. Its IUPAC name is chloroplatinum(1+);(8E,23E)-1,16-diphenyl-1,16-diphosphacyclotriaconta-8,23-diene;1,2,3,4,5-pentafluorobenzene-6-ide.
| Compound Name | chloroplatinum(1+);(8E,23E)-1,16-diphenyl-1,16-diphosphacyclotriaconta-8,23-diene;1,2,3,4,5-pentafluorobenzene-6-ide |
|---|---|
| PubChem CID | 11320642 |
| Molecular Formula | C46H62ClF5P2Pt |
| Molecular Weight | 1002.47 g/mol |
| Exact Mass | 1001.36 |
| IUPAC Name | chloroplatinum(1+);(8E,23E)-1,16-diphenyl-1,16-diphosphacyclotriaconta-8,23-diene;1,2,3,4,5-pentafluorobenzene-6-ide |
| SMILES | C1=C/CCCCCCP(c2ccccc2)CCCCCC/C=C/CCCCCCP(c2ccccc2)CCCCCC/1.Cl[Pt+].Fc1[c-]c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C40H62P2.C6F5.ClH.Pt/c1-2-6-10-14-18-28-36-42(40-33-25-22-26-34-40)38-30-20-16-12-8-4-3-7-11-15-19-29-37-41(35-27-17-13-9-5-1)39-31-23-21-24-32-39;7-2-1-3(8)5(10)6(11)4(2)9;;/h1-4,21-26,31-34H,5-20,27-30,35-38H2;;1H;/q;-1;;+2/p-1/b2-1+,4-3+;;; |
| InChIKey | VTAQXNYMOIKBFM-VYDFLQMFSA-M |
| XLogP | 15.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.47 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|