About 1,5-diphenyl-1,5-diphosphocane
1,5-diphenyl-1,5-diphosphocane (PubChem CID 14738745) has the molecular formula C18H22P2
and a molecular weight of 300.32 g/mol. Its IUPAC name is 1,5-diphenyl-1,5-diphosphocane.
Molecular Properties
| Compound Name | 1,5-diphenyl-1,5-diphosphocane |
| PubChem CID | 14738745 |
| Molecular Formula | C18H22P2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1,5-diphenyl-1,5-diphosphocane |
| SMILES | c1ccc(P2CCCP(c3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C18H22P2/c1-3-9-17(10-4-1)19-13-7-15-20(16-8-14-19)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2 |
| InChIKey | GDIQKZBJYRMXLR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,5-diphenyl-1,5-diphosphocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenyl-1,5-diphosphocane?
The IUPAC name of 1,5-diphenyl-1,5-diphosphocane (CID 14738745) is 1,5-diphenyl-1,5-diphosphocane.
What is the SMILES notation for 1,5-diphenyl-1,5-diphosphocane?
The canonical SMILES for 1,5-diphenyl-1,5-diphosphocane is c1ccc(P2CCCP(c3ccccc3)CCC2)cc1.
What is the InChIKey of 1,5-diphenyl-1,5-diphosphocane?
The InChIKey is GDIQKZBJYRMXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22P2/c1-3-9-17(10-4-1)19-13-7-15-20(16-8-14-19)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2.
What are the key properties of 1,5-diphenyl-1,5-diphosphocane?
1,5-diphenyl-1,5-diphosphocane has a molecular weight of 300.32 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenyl-1,5-diphosphocane is sourced from PubChem (CID 14738745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).