C11H16P2 — CID 156579193
1-ethyl-2-phenyldiphospholane (PubChem CID 156579193) has the molecular formula C11H16P2 and a molecular weight of 210.20 g/mol. Its IUPAC name is 1-ethyl-2-phenyldiphospholane.
| Compound Name | 1-ethyl-2-phenyldiphospholane |
|---|---|
| PubChem CID | 156579193 |
| Molecular Formula | C11H16P2 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-ethyl-2-phenyldiphospholane |
| SMILES | CCP1CCCP1c1ccccc1 |
| InChI | InChI=1S/C11H16P2/c1-2-12-9-6-10-13(12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3 |
| InChIKey | MXIACJWAQASVOF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|