C14H22NP — CID 91597144
2,2,6,6-tetramethyl-4-phenyl-1,4-azaphosphinane (PubChem CID 91597144) has the molecular formula C14H22NP and a molecular weight of 235.31 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-phenyl-1,4-azaphosphinane.
| Compound Name | 2,2,6,6-tetramethyl-4-phenyl-1,4-azaphosphinane |
|---|---|
| PubChem CID | 91597144 |
| Molecular Formula | C14H22NP |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-phenyl-1,4-azaphosphinane |
| SMILES | CC1(C)CP(c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C14H22NP/c1-13(2)10-16(11-14(3,4)15-13)12-8-6-5-7-9-12/h5-9,15H,10-11H2,1-4H3 |
| InChIKey | CAMSMGXSZZEUHQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|