About (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine
(2R,4S)-2,4-dimethyl-4-phenylpyrrolidine (PubChem CID 102398914) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine.
Molecular Properties
| Compound Name | (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine |
| PubChem CID | 102398914 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine |
| SMILES | C[C@@H]1C[C@@](C)(c2ccccc2)CN1 |
| InChI | InChI=1S/C12H17N/c1-10-8-12(2,9-13-10)11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | ZLIWJQDBPNLMPD-ZYHUDNBSSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine?
The IUPAC name of (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine (CID 102398914) is (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine.
What is the SMILES notation for (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine?
The canonical SMILES for (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine is C[C@@H]1C[C@@](C)(c2ccccc2)CN1.
What is the InChIKey of (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine?
The InChIKey is ZLIWJQDBPNLMPD-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H17N/c1-10-8-12(2,9-13-10)11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3/t10-,12-/m1/s1.
What are the key properties of (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine?
(2R,4S)-2,4-dimethyl-4-phenylpyrrolidine has a molecular weight of 175.28 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2,4-dimethyl-4-phenylpyrrolidine is sourced from PubChem (CID 102398914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).