C15H22N2 — CID 64844166
2,5-dimethyl-2-phenyl-1-prop-2-enylpiperazine (PubChem CID 64844166) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2,5-dimethyl-2-phenyl-1-prop-2-enylpiperazine.
| Compound Name | 2,5-dimethyl-2-phenyl-1-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 64844166 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,5-dimethyl-2-phenyl-1-prop-2-enylpiperazine |
| SMILES | C=CCN1CC(C)NCC1(C)c1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-4-10-17-11-13(2)16-12-15(17,3)14-8-6-5-7-9-14/h4-9,13,16H,1,10-12H2,2-3H3 |
| InChIKey | SRCUXYVLEKWTBQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|