C12H13NS — CID 7707260
(2R)-2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione (PubChem CID 7707260) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is (2R)-2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione.
| Compound Name | (2R)-2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione |
|---|---|
| PubChem CID | 7707260 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (2R)-2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione |
| SMILES | C[C@@H]1CC=C(c2ccccc2)C(=S)N1 |
| InChI | InChI=1S/C12H13NS/c1-9-7-8-11(12(14)13-9)10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | UJEYHIWKFIXAEE-SECBINFHSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|