C13H15N — CID 146321174
3-methyl-6-phenylcyclohexa-1,5-dien-1-amine (PubChem CID 146321174) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-methyl-6-phenylcyclohexa-1,5-dien-1-amine.
| Compound Name | 3-methyl-6-phenylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 146321174 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-methyl-6-phenylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1C=C(N)C(c2ccccc2)=CC1 |
| InChI | InChI=1S/C13H15N/c1-10-7-8-12(13(14)9-10)11-5-3-2-4-6-11/h2-6,8-10H,7,14H2,1H3 |
| InChIKey | USHHCIZPSLOQID-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |