C12H12IN — CID 163958726
6-iodo-3-methyl-5-phenyl-2,3-dihydropyridine (PubChem CID 163958726) has the molecular formula C12H12IN and a molecular weight of 297.14 g/mol. Its IUPAC name is 6-iodo-3-methyl-5-phenyl-2,3-dihydropyridine.
| Compound Name | 6-iodo-3-methyl-5-phenyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 163958726 |
| Molecular Formula | C12H12IN |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 6-iodo-3-methyl-5-phenyl-2,3-dihydropyridine |
| SMILES | CC1C=C(c2ccccc2)C(I)=NC1 |
| InChI | InChI=1S/C12H12IN/c1-9-7-11(12(13)14-8-9)10-5-3-2-4-6-10/h2-7,9H,8H2,1H3 |
| InChIKey | SFPXUNIXCDXHBO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|