C12H16OSi — CID 101442946
2,2,3-trimethyl-5-phenyl-3H-oxasilole (PubChem CID 101442946) has the molecular formula C12H16OSi and a molecular weight of 204.35 g/mol. Its IUPAC name is 2,2,3-trimethyl-5-phenyl-3H-oxasilole.
| Compound Name | 2,2,3-trimethyl-5-phenyl-3H-oxasilole |
|---|---|
| PubChem CID | 101442946 |
| Molecular Formula | C12H16OSi |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2,2,3-trimethyl-5-phenyl-3H-oxasilole |
| SMILES | CC1C=C(c2ccccc2)O[Si]1(C)C |
| InChI | InChI=1S/C12H16OSi/c1-10-9-12(13-14(10,2)3)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | UNMBYRVMPYARTJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|