C13H13Cl2Zr — CID 87777027
(3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;zirconium(3+);dichloride (PubChem CID 87777027) has the molecular formula C13H13Cl2Zr and a molecular weight of 331.38 g/mol. Its IUPAC name is (3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;zirconium(3+);dichloride.
| Compound Name | (3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 87777027 |
| Molecular Formula | C13H13Cl2Zr |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | (3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;zirconium(3+);dichloride |
| SMILES | CC1=[C-]C(C)C=C1c1ccccc1.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C13H13.2ClH.Zr/c1-10-8-11(2)13(9-10)12-6-4-3-5-7-12;;;/h3-7,9-10H,1-2H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | LWLYBFTVYVXLPZ-UHFFFAOYSA-L |
| XLogP | -2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|