C35H40Zr — CID 173138283
3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;methylidenezirconium(2+) (PubChem CID 173138283) has the molecular formula C35H40Zr and a molecular weight of 551.93 g/mol. Its IUPAC name is 3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;methylidenezirconium(2+).
| Compound Name | 3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;methylidenezirconium(2+) |
|---|---|
| PubChem CID | 173138283 |
| Molecular Formula | C35H40Zr |
| Molecular Weight | 551.93 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)benzene;methylidenezirconium(2+) |
| SMILES | C=[Zr+2].CC(C)(C)c1c[c-]c2c(c1)-c1cc(C(C)(C)C)ccc1C2.CC1=[C-]C(C)C=C1c1ccccc1 |
| InChI | InChI=1S/C21H25.C13H13.CH2.Zr/c1-20(2,3)16-9-7-14-11-15-8-10-17(21(4,5)6)13-19(15)18(14)12-16;1-10-8-11(2)13(9-10)12-6-4-3-5-7-12;;/h7,9-10,12-13H,11H2,1-6H3;3-7,9-10H,1-2H3;1H2;/q2*-1;;+2 |
| InChIKey | DRNSKVOHGLILGO-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.93 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|