C46H46Zr — CID 140511480
benzhydrylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3-methylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 140511480) has the molecular formula C46H46Zr and a molecular weight of 690.10 g/mol. Its IUPAC name is benzhydrylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3-methylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | benzhydrylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3-methylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 140511480 |
| Molecular Formula | C46H46Zr |
| Molecular Weight | 690.10 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | benzhydrylidenezirconium(2+);3,6-ditert-butyl-1,9-dihydrofluoren-1-ide;(3-methylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | CC(C)(C)c1c[c-]c2c(c1)-c1cc(C(C)(C)C)ccc1C2.CC1[C-]=CC(c2ccccc2)=C1.[Zr+2]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25.C13H10.C12H11.Zr/c1-20(2,3)16-9-7-14-11-15-8-10-17(21(4,5)6)13-19(15)18(14)12-16;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-10-7-8-12(9-10)11-5-3-2-4-6-11;/h7,9-10,12-13H,11H2,1-6H3;1-10H;2-6,8-10H,1H3;/q-1;;-1;+2 |
| InChIKey | JXSZFJNVFURMPK-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.10 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|