About 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione
3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione (PubChem CID 130009663) has the molecular formula C10H11NS2
and a molecular weight of 209.34 g/mol. Its IUPAC name is 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione.
Molecular Properties
| Compound Name | 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione |
| PubChem CID | 130009663 |
| Molecular Formula | C10H11NS2 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione |
| SMILES | CC1CSc2ccccc2C(=S)N1 |
| InChI | InChI=1S/C10H11NS2/c1-7-6-13-9-5-3-2-4-8(9)10(12)11-7/h2-5,7H,6H2,1H3,(H,11,12) |
| InChIKey | MKTDBSSKSAMLKS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione?
The IUPAC name of 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione (CID 130009663) is 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione.
What is the SMILES notation for 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione?
The canonical SMILES for 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione is CC1CSc2ccccc2C(=S)N1.
What is the InChIKey of 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione?
The InChIKey is MKTDBSSKSAMLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS2/c1-7-6-13-9-5-3-2-4-8(9)10(12)11-7/h2-5,7H,6H2,1H3,(H,11,12).
What are the key properties of 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione?
3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione has a molecular weight of 209.34 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,4-dihydro-2H-1,4-benzothiazepine-5-thione is sourced from PubChem (CID 130009663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).