C21H26O6P2 — CID 87909825
3,9-bis(1-phenylethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 87909825) has the molecular formula C21H26O6P2 and a molecular weight of 436.38 g/mol. Its IUPAC name is 3,9-bis(1-phenylethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis(1-phenylethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 87909825 |
| Molecular Formula | C21H26O6P2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3,9-bis(1-phenylethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CC(OP1OCC2(CO1)COP(OC(C)c1ccccc1)OC2)c1ccccc1 |
| InChI | InChI=1S/C21H26O6P2/c1-17(19-9-5-3-6-10-19)26-28-22-13-21(14-23-28)15-24-29(25-16-21)27-18(2)20-11-7-4-8-12-20/h3-12,17-18H,13-16H2,1-2H3 |
| InChIKey | YPNFXILVDBCCMZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|