C29H26N2OP2 — CID 102341518
4,5-bis(diphenylphosphanyl)-1,3-dimethylimidazol-2-one (PubChem CID 102341518) has the molecular formula C29H26N2OP2 and a molecular weight of 480.49 g/mol. Its IUPAC name is 4,5-bis(diphenylphosphanyl)-1,3-dimethylimidazol-2-one.
| Compound Name | 4,5-bis(diphenylphosphanyl)-1,3-dimethylimidazol-2-one |
|---|---|
| PubChem CID | 102341518 |
| Molecular Formula | C29H26N2OP2 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 4,5-bis(diphenylphosphanyl)-1,3-dimethylimidazol-2-one |
| SMILES | Cn1c(P(c2ccccc2)c2ccccc2)c(P(c2ccccc2)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C29H26N2OP2/c1-30-27(33(23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(31(2)29(30)32)34(25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | IYUFYEIJDBZJAH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|