C23H24F3N5O2 — CID 1259521
(5R,7S)-5-(4-methoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1259521) has the molecular formula C23H24F3N5O2 and a molecular weight of 459.47 g/mol. Its IUPAC name is (5R,7S)-5-(4-methoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-5-(4-methoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1259521 |
| Molecular Formula | C23H24F3N5O2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (5R,7S)-5-(4-methoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)N(C)CCc4ccccn4)cc3N2)cc1 |
| InChI | InChI=1S/C23H24F3N5O2/c1-30(12-10-16-5-3-4-11-27-16)22(32)19-14-21-28-18(15-6-8-17(33-2)9-7-15)13-20(23(24,25)26)31(21)29-19/h3-9,11,14,18,20,28H,10,12-13H2,1-2H3/t18-,20+/m1/s1 |
| InChIKey | MMIODXWDJDHKIC-QUCCMNQESA-N |
| XLogP | 4.26 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |