C15H16ClNO3 — CID 12595576
8-(3-chlorophenyl)-8-isocyanato-1,4-dioxaspiro[4.5]decane (PubChem CID 12595576) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-8-isocyanato-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-(3-chlorophenyl)-8-isocyanato-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 12595576 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 8-(3-chlorophenyl)-8-isocyanato-1,4-dioxaspiro[4.5]decane |
| SMILES | O=C=NC1(c2cccc(Cl)c2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H16ClNO3/c16-13-3-1-2-12(10-13)14(17-11-18)4-6-15(7-5-14)19-8-9-20-15/h1-3,10H,4-9H2 |
| InChIKey | PPFZVAQDLISFAR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|