C12H20O4 — CID 12599686
[(E)-5-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate (PubChem CID 12599686) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(E)-5-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate.
| Compound Name | [(E)-5-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 12599686 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(E)-5-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CCC1OC1(C)CO |
| InChI | InChI=1S/C12H20O4/c1-9(6-7-15-10(2)14)4-5-11-12(3,8-13)16-11/h6,11,13H,4-5,7-8H2,1-3H3/b9-6+ |
| InChIKey | DXFKXKBFCSDMPA-RMKNXTFCSA-N |
| XLogP | 1.43 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|