C17H28O4 — CID 162983528
[(1S,3R,4E,8S,9R,10R)-9-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] acetate (PubChem CID 162983528) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(1S,3R,4E,8S,9R,10R)-9-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] acetate.
| Compound Name | [(1S,3R,4E,8S,9R,10R)-9-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 162983528 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(1S,3R,4E,8S,9R,10R)-9-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxabicyclo[8.1.0]undec-4-en-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C(\C)CC[C@@H](C(C)C)[C@@H](O)[C@H]2O[C@@]2(C)C1 |
| InChI | InChI=1S/C17H28O4/c1-10(2)14-7-6-11(3)8-13(20-12(4)18)9-17(5)16(21-17)15(14)19/h8,10,13-16,19H,6-7,9H2,1-5H3/b11-8+/t13-,14-,15+,16+,17-/m0/s1 |
| InChIKey | KAORYHGWGQFHAO-PFGQDBQFSA-N |
| XLogP | 2.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|