C31H26IN3O6S — CID 126002437
ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-oxo-7-phenyl-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126002437) has the molecular formula C31H26IN3O6S and a molecular weight of 695.54 g/mol. Its IUPAC name is ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-oxo-7-phenyl-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-oxo-7-phenyl-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126002437 |
| Molecular Formula | C31H26IN3O6S |
| Molecular Weight | 695.54 g/mol |
| Exact Mass | 695.06 |
| IUPAC Name | ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-3-oxo-7-phenyl-5-(4-propan-2-ylphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3cc(I)c(O)c([N+](=O)[O-])c3)c(=O)n2[C@H]1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C31H26IN3O6S/c1-4-41-30(38)25-26(20-8-6-5-7-9-20)33-31-34(27(25)21-12-10-19(11-13-21)17(2)3)29(37)24(42-31)16-18-14-22(32)28(36)23(15-18)35(39)40/h5-17,27,36H,4H2,1-3H3/b24-16-/t27-/m0/s1 |
| InChIKey | NMWYGOCCAIUKRF-QFDNUGPTSA-N |
| XLogP | 5.28 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|