C29H22IN3O7S — CID 124602049
ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 124602049) has the molecular formula C29H22IN3O7S and a molecular weight of 683.48 g/mol. Its IUPAC name is ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 124602049 |
| Molecular Formula | C29H22IN3O7S |
| Molecular Weight | 683.48 g/mol |
| Exact Mass | 683.02 |
| IUPAC Name | ethyl (2Z,5S)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-5-(4-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3cc(I)c(O)c([N+](=O)[O-])c3)c(=O)n2[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H22IN3O7S/c1-3-40-28(36)23-24(17-7-5-4-6-8-17)31-29-32(25(23)18-9-11-19(39-2)12-10-18)27(35)22(41-29)15-16-13-20(30)26(34)21(14-16)33(37)38/h4-15,25,34H,3H2,1-2H3/b22-15-/t25-/m0/s1 |
| InChIKey | UNQMYTJKAAESMR-GMPUOFRTSA-N |
| XLogP | 4.16 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|