C25H23BrF3N5O3 — CID 126002582
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126002582) has the molecular formula C25H23BrF3N5O3 and a molecular weight of 578.39 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126002582 |
| Molecular Formula | C25H23BrF3N5O3 |
| Molecular Weight | 578.39 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C/c2cc(C)n(-c3cccc(C(F)(F)F)c3)c2C)c1C#N |
| InChI | InChI=1S/C25H23BrF3N5O3/c1-14-8-17(16(3)34(14)19-7-5-6-18(9-19)25(27,28)29)11-31-33-22(35)13-37-24-20(10-30)21(12-36-4)23(26)15(2)32-24/h5-9,11H,12-13H2,1-4H3,(H,33,35)/b31-11+ |
| InChIKey | GACRTTVKIDQVIA-QFDQHJFZSA-N |
| XLogP | 5.13 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|