C35H30BrN5O3 — CID 46495755
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 46495755) has the molecular formula C35H30BrN5O3 and a molecular weight of 648.56 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 46495755 |
| Molecular Formula | C35H30BrN5O3 |
| Molecular Weight | 648.56 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C/c2cc(-c3ccccc3)n(-c3ccc(C)cc3)c2-c2ccccc2)c1C#N |
| InChI | InChI=1S/C35H30BrN5O3/c1-23-14-16-28(17-15-23)41-31(25-10-6-4-7-11-25)18-27(34(41)26-12-8-5-9-13-26)20-38-40-32(42)22-44-35-29(19-37)30(21-43-3)33(36)24(2)39-35/h4-18,20H,21-22H2,1-3H3,(H,40,42)/b38-20+ |
| InChIKey | NOCFDZDUOPUHFG-CHSHITCJSA-N |
| XLogP | 7.13 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|