C22H17BrN2O2 — CID 126002683
(6S,6aR,11bS)-6-(4-bromophenyl)-2-nitro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline (PubChem CID 126002683) has the molecular formula C22H17BrN2O2 and a molecular weight of 421.29 g/mol. Its IUPAC name is (6S,6aR,11bS)-6-(4-bromophenyl)-2-nitro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline.
| Compound Name | (6S,6aR,11bS)-6-(4-bromophenyl)-2-nitro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline |
|---|---|
| PubChem CID | 126002683 |
| Molecular Formula | C22H17BrN2O2 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | (6S,6aR,11bS)-6-(4-bromophenyl)-2-nitro-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H]1c3ccccc3C[C@H]1[C@@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C22H17BrN2O2/c23-15-7-5-13(6-8-15)22-19-11-14-3-1-2-4-17(14)21(19)18-12-16(25(26)27)9-10-20(18)24-22/h1-10,12,19,21-22,24H,11H2/t19-,21+,22-/m1/s1 |
| InChIKey | KVDHFXXRFBKMCW-BAGYTPMASA-N |
| XLogP | 5.83 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|