C23H18N2O4 — CID 126343638
(6R,6aR,11bS)-6-(2-nitrophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid (PubChem CID 126343638) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is (6R,6aR,11bS)-6-(2-nitrophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid.
| Compound Name | (6R,6aR,11bS)-6-(2-nitrophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 126343638 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (6R,6aR,11bS)-6-(2-nitrophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@@H]1c3ccccc3C[C@H]1[C@H](c1ccccc1[N+](=O)[O-])N2 |
| InChI | InChI=1S/C23H18N2O4/c26-23(27)14-9-10-19-17(12-14)21-15-6-2-1-5-13(15)11-18(21)22(24-19)16-7-3-4-8-20(16)25(28)29/h1-10,12,18,21-22,24H,11H2,(H,26,27)/t18-,21+,22+/m1/s1 |
| InChIKey | VUPOFQHXECKPIB-COPCDDAFSA-N |
| XLogP | 4.76 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|