C23H17Cl2NO2 — CID 126001289
(6R,6aR,11bS)-6-(2,4-dichlorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid (PubChem CID 126001289) has the molecular formula C23H17Cl2NO2 and a molecular weight of 410.30 g/mol. Its IUPAC name is (6R,6aR,11bS)-6-(2,4-dichlorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid.
| Compound Name | (6R,6aR,11bS)-6-(2,4-dichlorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 126001289 |
| Molecular Formula | C23H17Cl2NO2 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | (6R,6aR,11bS)-6-(2,4-dichlorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@@H]1c3ccccc3C[C@H]1[C@H](c1ccc(Cl)cc1Cl)N2 |
| InChI | InChI=1S/C23H17Cl2NO2/c24-14-6-7-16(19(25)11-14)22-18-9-12-3-1-2-4-15(12)21(18)17-10-13(23(27)28)5-8-20(17)26-22/h1-8,10-11,18,21-22,26H,9H2,(H,27,28)/t18-,21+,22+/m1/s1 |
| InChIKey | IJUNNVMAHVBRTQ-COPCDDAFSA-N |
| XLogP | 6.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |