C23H18FNO2 — CID 126001125
(6R,6aR,11bS)-6-(2-fluorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid (PubChem CID 126001125) has the molecular formula C23H18FNO2 and a molecular weight of 359.40 g/mol. Its IUPAC name is (6R,6aR,11bS)-6-(2-fluorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid.
| Compound Name | (6R,6aR,11bS)-6-(2-fluorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 126001125 |
| Molecular Formula | C23H18FNO2 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (6R,6aR,11bS)-6-(2-fluorophenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)[C@@H]1c3ccccc3C[C@H]1[C@H](c1ccccc1F)N2 |
| InChI | InChI=1S/C23H18FNO2/c24-19-8-4-3-7-16(19)22-18-11-13-5-1-2-6-15(13)21(18)17-12-14(23(26)27)9-10-20(17)25-22/h1-10,12,18,21-22,25H,11H2,(H,26,27)/t18-,21+,22+/m1/s1 |
| InChIKey | HVAZXJPBUOWOOM-COPCDDAFSA-N |
| XLogP | 4.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |