C36H28N4O10S — CID 126003264
ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-5-(3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126003264) has the molecular formula C36H28N4O10S and a molecular weight of 708.71 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-5-(3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-5-(3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126003264 |
| Molecular Formula | C36H28N4O10S |
| Molecular Weight | 708.71 g/mol |
| Exact Mass | 708.15 |
| IUPAC Name | ethyl (2Z,5R)-2-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-5-(3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c(OC)c3)c(=O)n2[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C36H28N4O10S/c1-4-49-35(42)31-32(22-9-6-5-7-10-22)37-36-38(33(31)23-11-8-12-25(19-23)47-2)34(41)30(51-36)18-21-13-15-28(29(17-21)48-3)50-27-16-14-24(39(43)44)20-26(27)40(45)46/h5-20,33H,4H2,1-3H3/b30-18-/t33-/m1/s1 |
| InChIKey | LVLBHOUNLSZLQP-VEOKEAFVSA-N |
| XLogP | 5.56 |
| TPSA | 174.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|