C37H30N4O11S — CID 99687897
ethyl (2E,5R)-2-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 99687897) has the molecular formula C37H30N4O11S and a molecular weight of 738.73 g/mol. Its IUPAC name is ethyl (2E,5R)-2-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5R)-2-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 99687897 |
| Molecular Formula | C37H30N4O11S |
| Molecular Weight | 738.73 g/mol |
| Exact Mass | 738.16 |
| IUPAC Name | ethyl (2E,5R)-2-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-5-(4-hydroxy-3-methoxyphenyl)-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C/c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c(OCC)c3)c(=O)n2[C@@H]1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C37H30N4O11S/c1-4-50-30-17-21(11-15-28(30)52-27-16-13-24(40(45)46)20-25(27)41(47)48)18-31-35(43)39-34(23-12-14-26(42)29(19-23)49-3)32(36(44)51-5-2)33(38-37(39)53-31)22-9-7-6-8-10-22/h6-20,34,42H,4-5H2,1-3H3/b31-18+/t34-/m1/s1 |
| InChIKey | RYMXALFBFUHYKD-LHBBPENESA-N |
| XLogP | 5.66 |
| TPSA | 194.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|